About 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole
3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole (PubChem CID 115046380) has the molecular formula C13H10ClFN2
and a molecular weight of 248.69 g/mol. Its IUPAC name is 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole |
| PubChem CID | 115046380 |
| Molecular Formula | C13H10ClFN2 |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole |
| SMILES | Cc1nc(Cl)cc2c3ccc(F)cc3n(C)c12 |
| InChI | InChI=1S/C13H10ClFN2/c1-7-13-10(6-12(14)16-7)9-4-3-8(15)5-11(9)17(13)2/h3-6H,1-2H3 |
| InChIKey | GZIGMJAMGLMOTP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole?
The IUPAC name of 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole (CID 115046380) is 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole.
What is the SMILES notation for 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole?
The canonical SMILES for 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole is Cc1nc(Cl)cc2c3ccc(F)cc3n(C)c12.
What is the InChIKey of 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole?
The InChIKey is GZIGMJAMGLMOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClFN2/c1-7-13-10(6-12(14)16-7)9-4-3-8(15)5-11(9)17(13)2/h3-6H,1-2H3.
What are the key properties of 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole?
3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole has a molecular weight of 248.69 g/mol, XLogP of 3.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-7-fluoro-1,9-dimethylpyrido[3,4-b]indole is sourced from PubChem (CID 115046380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).