C16H13NO2 — CID 115046801
3-(2-benzyl-1,3-oxazol-4-yl)phenol (PubChem CID 115046801) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-(2-benzyl-1,3-oxazol-4-yl)phenol.
| Compound Name | 3-(2-benzyl-1,3-oxazol-4-yl)phenol |
|---|---|
| PubChem CID | 115046801 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 3-(2-benzyl-1,3-oxazol-4-yl)phenol |
| SMILES | Oc1cccc(-c2coc(Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C16H13NO2/c18-14-8-4-7-13(10-14)15-11-19-16(17-15)9-12-5-2-1-3-6-12/h1-8,10-11,18H,9H2 |
| InChIKey | LQYQIFOAFVYMAT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |