C22H22N6O4S3 — CID 11504690
3-[[4-(4-acetylpiperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide (PubChem CID 11504690) has the molecular formula C22H22N6O4S3 and a molecular weight of 530.66 g/mol. Its IUPAC name is 3-[[4-(4-acetylpiperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-(4-acetylpiperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 11504690 |
| Molecular Formula | C22H22N6O4S3 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 3-[[4-(4-acetylpiperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide |
| SMILES | CC(=O)N1CCN(C(=O)c2cc3c(s2)CSc2cnc(Nc4cccc(S(N)(=O)=O)c4)nc2-3)CC1 |
| InChI | InChI=1S/C22H22N6O4S3/c1-13(29)27-5-7-28(8-6-27)21(30)17-10-16-19(34-17)12-33-18-11-24-22(26-20(16)18)25-14-3-2-4-15(9-14)35(23,31)32/h2-4,9-11H,5-8,12H2,1H3,(H2,23,31,32)(H,24,25,26) |
| InChIKey | HPFIWJYPUBFGNS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |