C10H8BrNO2 — CID 115047212
[5-(2-bromophenyl)-1,3-oxazol-2-yl]methanol (PubChem CID 115047212) has the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. Its IUPAC name is [5-(2-bromophenyl)-1,3-oxazol-2-yl]methanol.
| Compound Name | [5-(2-bromophenyl)-1,3-oxazol-2-yl]methanol |
|---|---|
| PubChem CID | 115047212 |
| Molecular Formula | C10H8BrNO2 |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | [5-(2-bromophenyl)-1,3-oxazol-2-yl]methanol |
| SMILES | OCc1ncc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C10H8BrNO2/c11-8-4-2-1-3-7(8)9-5-12-10(6-13)14-9/h1-5,13H,6H2 |
| InChIKey | YWZRVJPJJOVGPD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |