C11H16N2O3S — CID 115047842
3-(aminomethyl)-6-(1,1-dioxothian-4-yl)-1H-pyridin-2-one (PubChem CID 115047842) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-(aminomethyl)-6-(1,1-dioxothian-4-yl)-1H-pyridin-2-one.
| Compound Name | 3-(aminomethyl)-6-(1,1-dioxothian-4-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 115047842 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-(aminomethyl)-6-(1,1-dioxothian-4-yl)-1H-pyridin-2-one |
| SMILES | NCc1ccc(C2CCS(=O)(=O)CC2)[nH]c1=O |
| InChI | InChI=1S/C11H16N2O3S/c12-7-9-1-2-10(13-11(9)14)8-3-5-17(15,16)6-4-8/h1-2,8H,3-7,12H2,(H,13,14) |
| InChIKey | CUKSPKXDTPJEIA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |