About 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid
3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid (PubChem CID 115048616) has the molecular formula C11H16O5S
and a molecular weight of 260.31 g/mol. Its IUPAC name is 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid |
| PubChem CID | 115048616 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid |
| SMILES | O=C(O)CCC1C2CC(=O)CC1CS(=O)(=O)C2 |
| InChI | InChI=1S/C11H16O5S/c12-9-3-7-5-17(15,16)6-8(4-9)10(7)1-2-11(13)14/h7-8,10H,1-6H2,(H,13,14) |
| InChIKey | TZCYDQTZUNMPAR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid?
The IUPAC name of 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid (CID 115048616) is 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid.
What is the SMILES notation for 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid?
The canonical SMILES for 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid is O=C(O)CCC1C2CC(=O)CC1CS(=O)(=O)C2.
What is the InChIKey of 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid?
The InChIKey is TZCYDQTZUNMPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5S/c12-9-3-7-5-17(15,16)6-8(4-9)10(7)1-2-11(13)14/h7-8,10H,1-6H2,(H,13,14).
What are the key properties of 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid?
3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid has a molecular weight of 260.31 g/mol, XLogP of 0.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3,7-trioxo-3λ6-thiabicyclo[3.3.1]nonan-9-yl)propanoic acid is sourced from PubChem (CID 115048616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).