2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid

C9H11NO4S2 — CID 115048826

IUPAC2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(C2CCCS(=O)(=O)C2)s1
InChIInChI=1S/C9H11NO4S2/c11-9(12)7-4-10-8(15-7)6-2-1-3-16(13,14)5-6/h4,6H,1-3,5H2,(H,11,12)
InChIKeyWEINZBNFRHYNEZ-UHFFFAOYSA-N
MW261.32 g/mol
LogP1.13
Rot. Bonds2

About 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid

2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 115048826) has the molecular formula C9H11NO4S2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid
PubChem CID115048826
Molecular FormulaC9H11NO4S2
Molecular Weight261.32 g/mol
Exact Mass261.01
IUPAC Name2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(C2CCCS(=O)(=O)C2)s1
InChIInChI=1S/C9H11NO4S2/c11-9(12)7-4-10-8(15-7)6-2-1-3-16(13,14)5-6/h4,6H,1-3,5H2,(H,11,12)
InChIKeyWEINZBNFRHYNEZ-UHFFFAOYSA-N
XLogP1.13
TPSA84.33 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.32
LogP ≤ 51.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid (CID 115048826) is 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(C2CCCS(=O)(=O)C2)s1.
What is the InChIKey of 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is WEINZBNFRHYNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4S2/c11-9(12)7-4-10-8(15-7)6-2-1-3-16(13,14)5-6/h4,6H,1-3,5H2,(H,11,12).
What are the key properties of 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid?
2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 261.32 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothian-3-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 115048826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).