C13H24FNO3 — CID 115048842
tert-butyl 3-(2-fluoropropyl)-4-(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 115048842) has the molecular formula C13H24FNO3 and a molecular weight of 261.34 g/mol. Its IUPAC name is tert-butyl 3-(2-fluoropropyl)-4-(hydroxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-fluoropropyl)-4-(hydroxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 115048842 |
| Molecular Formula | C13H24FNO3 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | tert-butyl 3-(2-fluoropropyl)-4-(hydroxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(F)CC1CN(C(=O)OC(C)(C)C)CC1CO |
| InChI | InChI=1S/C13H24FNO3/c1-9(14)5-10-6-15(7-11(10)8-16)12(17)18-13(2,3)4/h9-11,16H,5-8H2,1-4H3 |
| InChIKey | YIGRKTWZHZNPBG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |