C12H20FNO2S — CID 115048853
4-(5-fluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)thiane 1,1-dioxide (PubChem CID 115048853) has the molecular formula C12H20FNO2S and a molecular weight of 261.36 g/mol. Its IUPAC name is 4-(5-fluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)thiane 1,1-dioxide.
| Compound Name | 4-(5-fluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 115048853 |
| Molecular Formula | C12H20FNO2S |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 4-(5-fluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C2(F)CC3CNCC3C2)CC1 |
| InChI | InChI=1S/C12H20FNO2S/c13-12(5-9-7-14-8-10(9)6-12)11-1-3-17(15,16)4-2-11/h9-11,14H,1-8H2 |
| InChIKey | UYIRCUZULXKDGG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |