C9H12BrNOS — CID 115048963
2-bromo-5-(2-methyloxan-2-yl)-1,3-thiazole (PubChem CID 115048963) has the molecular formula C9H12BrNOS and a molecular weight of 262.17 g/mol. Its IUPAC name is 2-bromo-5-(2-methyloxan-2-yl)-1,3-thiazole.
| Compound Name | 2-bromo-5-(2-methyloxan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 115048963 |
| Molecular Formula | C9H12BrNOS |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 2-bromo-5-(2-methyloxan-2-yl)-1,3-thiazole |
| SMILES | CC1(c2cnc(Br)s2)CCCCO1 |
| InChI | InChI=1S/C9H12BrNOS/c1-9(4-2-3-5-12-9)7-6-11-8(10)13-7/h6H,2-5H2,1H3 |
| InChIKey | BIKLPTRYQRURRT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |