About [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine
[1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine (PubChem CID 115049253) has the molecular formula C11H21FN2O2S
and a molecular weight of 264.37 g/mol. Its IUPAC name is [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine |
| PubChem CID | 115049253 |
| Molecular Formula | C11H21FN2O2S |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine |
| SMILES | NCC1(F)CCCN(C2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C11H21FN2O2S/c12-11(8-13)4-1-5-14(9-11)10-2-6-17(15,16)7-3-10/h10H,1-9,13H2 |
| InChIKey | ADKFJNYPILZAGY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine?
The IUPAC name of [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine (CID 115049253) is [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine.
What is the SMILES notation for [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine?
The canonical SMILES for [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine is NCC1(F)CCCN(C2CCS(=O)(=O)CC2)C1.
What is the InChIKey of [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine?
The InChIKey is ADKFJNYPILZAGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21FN2O2S/c12-11(8-13)4-1-5-14(9-11)10-2-6-17(15,16)7-3-10/h10H,1-9,13H2.
What are the key properties of [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine?
[1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine has a molecular weight of 264.37 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,1-dioxothian-4-yl)-3-fluoropiperidin-3-yl]methanamine is sourced from PubChem (CID 115049253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).