C11H21FN2O2S — CID 115049254
1-(1,1-dioxothian-4-yl)-4-(fluoromethyl)piperidin-4-amine (PubChem CID 115049254) has the molecular formula C11H21FN2O2S and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-4-(fluoromethyl)piperidin-4-amine.
| Compound Name | 1-(1,1-dioxothian-4-yl)-4-(fluoromethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 115049254 |
| Molecular Formula | C11H21FN2O2S |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-4-(fluoromethyl)piperidin-4-amine |
| SMILES | NC1(CF)CCN(C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C11H21FN2O2S/c12-9-11(13)3-5-14(6-4-11)10-1-7-17(15,16)8-2-10/h10H,1-9,13H2 |
| InChIKey | OBKHCHRKWOBYPO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |