C24H44ClN11O2 — CID 11504969
3,5-diamino-6-chloro-N-[N'-[4-[4-[5-[3-(dimethylamino)propylamino]-5-oxopentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11504969) has the molecular formula C24H44ClN11O2 and a molecular weight of 554.14 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[5-[3-(dimethylamino)propylamino]-5-oxopentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[5-[3-(dimethylamino)propylamino]-5-oxopentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11504969 |
| Molecular Formula | C24H44ClN11O2 |
| Molecular Weight | 554.14 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[5-[3-(dimethylamino)propylamino]-5-oxopentyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)CCCCN1CCN(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1 |
| InChI | InChI=1S/C24H44ClN11O2/c1-34(2)11-7-10-29-18(37)8-3-5-12-35-14-16-36(17-15-35)13-6-4-9-30-24(28)33-23(38)19-21(26)32-22(27)20(25)31-19/h3-17H2,1-2H3,(H,29,37)(H4,26,27,32)(H3,28,30,33,38) |
| InChIKey | HCFNDGKIPMXLHS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 184.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.14 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|