C13H18BrN — CID 115049925
1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine (PubChem CID 115049925) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine.
| Compound Name | 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 115049925 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine |
| SMILES | CN(C)C1(c2ccccc2Br)CCCC1 |
| InChI | InChI=1S/C13H18BrN/c1-15(2)13(9-5-6-10-13)11-7-3-4-8-12(11)14/h3-4,7-8H,5-6,9-10H2,1-2H3 |
| InChIKey | DWMXJZZYDZPOMA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |