About 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine
1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine (PubChem CID 115049925) has the molecular formula C13H18BrN
and a molecular weight of 268.20 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine |
| PubChem CID | 115049925 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine |
| SMILES | CN(C)C1(c2ccccc2Br)CCCC1 |
| InChI | InChI=1S/C13H18BrN/c1-15(2)13(9-5-6-10-13)11-7-3-4-8-12(11)14/h3-4,7-8H,5-6,9-10H2,1-2H3 |
| InChIKey | DWMXJZZYDZPOMA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine?
The IUPAC name of 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine (CID 115049925) is 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine.
What is the SMILES notation for 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine?
The canonical SMILES for 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine is CN(C)C1(c2ccccc2Br)CCCC1.
What is the InChIKey of 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine?
The InChIKey is DWMXJZZYDZPOMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrN/c1-15(2)13(9-5-6-10-13)11-7-3-4-8-12(11)14/h3-4,7-8H,5-6,9-10H2,1-2H3.
What are the key properties of 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine?
1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine has a molecular weight of 268.20 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromophenyl)-N,N-dimethylcyclopentan-1-amine is sourced from PubChem (CID 115049925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).