C13H18BrN — CID 115049926
1-[1-(4-bromophenyl)cyclobutyl]-N,N-dimethylmethanamine (PubChem CID 115049926) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)cyclobutyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[1-(4-bromophenyl)cyclobutyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 115049926 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-[1-(4-bromophenyl)cyclobutyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1(c2ccc(Br)cc2)CCC1 |
| InChI | InChI=1S/C13H18BrN/c1-15(2)10-13(8-3-9-13)11-4-6-12(14)7-5-11/h4-7H,3,8-10H2,1-2H3 |
| InChIKey | JGEBCKPFWZEUNA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |