C10H18F2N2O2S — CID 115049969
3-(difluoromethyl)-1-(1,1-dioxothian-4-yl)pyrrolidin-3-amine (PubChem CID 115049969) has the molecular formula C10H18F2N2O2S and a molecular weight of 268.33 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-(1,1-dioxothian-4-yl)pyrrolidin-3-amine.
| Compound Name | 3-(difluoromethyl)-1-(1,1-dioxothian-4-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 115049969 |
| Molecular Formula | C10H18F2N2O2S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-(difluoromethyl)-1-(1,1-dioxothian-4-yl)pyrrolidin-3-amine |
| SMILES | NC1(C(F)F)CCN(C2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C10H18F2N2O2S/c11-9(12)10(13)3-4-14(7-10)8-1-5-17(15,16)6-2-8/h8-9H,1-7,13H2 |
| InChIKey | LLJVYXBEHLFMDZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |