About 4-Methylbenzyl alcohol
4-Methylbenzyl alcohol (PubChem CID 11505) has the molecular formula C8H10O
and a molecular weight of 122.16 g/mol. Its IUPAC name is (4-methylphenyl)methanol.
Molecular Properties
| Compound Name | 4-Methylbenzyl alcohol |
| PubChem CID | 11505 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.16 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | (4-methylphenyl)methanol |
| SMILES | CC1=CC=C(C=C1)CO |
| InChI | InChI=1S/C8H10O/c1-7-2-4-8(6-9)5-3-7/h2-5,9H,6H2,1H3 |
| InChIKey | KMTDMTZBNYGUNX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | 72 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-Methylbenzyl alcohol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Methylbenzyl alcohol?
The IUPAC name of 4-Methylbenzyl alcohol (CID 11505) is (4-methylphenyl)methanol.
What is the SMILES notation for 4-Methylbenzyl alcohol?
The canonical SMILES for 4-Methylbenzyl alcohol is CC1=CC=C(C=C1)CO.
What is the InChIKey of 4-Methylbenzyl alcohol?
The InChIKey is KMTDMTZBNYGUNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-7-2-4-8(6-9)5-3-7/h2-5,9H,6H2,1H3.
What are the key properties of 4-Methylbenzyl alcohol?
4-Methylbenzyl alcohol has a molecular weight of 122.16 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Methylbenzyl alcohol is sourced from PubChem (CID 11505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).