C12H11F4N3 — CID 115050749
[2-fluoro-5-[5-methyl-2-(trifluoromethyl)-1H-imidazol-4-yl]phenyl]methanamine (PubChem CID 115050749) has the molecular formula C12H11F4N3 and a molecular weight of 273.23 g/mol. Its IUPAC name is [2-fluoro-5-[5-methyl-2-(trifluoromethyl)-1H-imidazol-4-yl]phenyl]methanamine.
| Compound Name | [2-fluoro-5-[5-methyl-2-(trifluoromethyl)-1H-imidazol-4-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 115050749 |
| Molecular Formula | C12H11F4N3 |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | [2-fluoro-5-[5-methyl-2-(trifluoromethyl)-1H-imidazol-4-yl]phenyl]methanamine |
| SMILES | Cc1[nH]c(C(F)(F)F)nc1-c1ccc(F)c(CN)c1 |
| InChI | InChI=1S/C12H11F4N3/c1-6-10(19-11(18-6)12(14,15)16)7-2-3-9(13)8(4-7)5-17/h2-4H,5,17H2,1H3,(H,18,19) |
| InChIKey | DDRUZVTWUHUGOT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |