C11H5F4NO3 — CID 115050945
2-fluoro-5-[2-(trifluoromethyl)-1,3-oxazol-4-yl]benzoic acid (PubChem CID 115050945) has the molecular formula C11H5F4NO3 and a molecular weight of 275.16 g/mol. Its IUPAC name is 2-fluoro-5-[2-(trifluoromethyl)-1,3-oxazol-4-yl]benzoic acid.
| Compound Name | 2-fluoro-5-[2-(trifluoromethyl)-1,3-oxazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 115050945 |
| Molecular Formula | C11H5F4NO3 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-fluoro-5-[2-(trifluoromethyl)-1,3-oxazol-4-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2coc(C(F)(F)F)n2)ccc1F |
| InChI | InChI=1S/C11H5F4NO3/c12-7-2-1-5(3-6(7)9(17)18)8-4-19-10(16-8)11(13,14)15/h1-4H,(H,17,18) |
| InChIKey | MHKAPEYOTOVBGH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |