About 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine
5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine (PubChem CID 115051030) has the molecular formula C12H10BrN3
and a molecular weight of 276.14 g/mol. Its IUPAC name is 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine.
Molecular Properties
| Compound Name | 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine |
| PubChem CID | 115051030 |
| Molecular Formula | C12H10BrN3 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine |
| SMILES | Cc1nc(N)cc2c1[nH]c1cccc(Br)c12 |
| InChI | InChI=1S/C12H10BrN3/c1-6-12-7(5-10(14)15-6)11-8(13)3-2-4-9(11)16-12/h2-5,16H,1H3,(H2,14,15) |
| InChIKey | DHUPBNXNUSYKSA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine?
The IUPAC name of 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine (CID 115051030) is 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine.
What is the SMILES notation for 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine?
The canonical SMILES for 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine is Cc1nc(N)cc2c1[nH]c1cccc(Br)c12.
What is the InChIKey of 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine?
The InChIKey is DHUPBNXNUSYKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrN3/c1-6-12-7(5-10(14)15-6)11-8(13)3-2-4-9(11)16-12/h2-5,16H,1H3,(H2,14,15).
What are the key properties of 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine?
5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine has a molecular weight of 276.14 g/mol, XLogP of 3.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-methyl-9H-pyrido[3,4-b]indol-3-amine is sourced from PubChem (CID 115051030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).