C11H6BrClN2 — CID 115051764
6-bromo-1-chloro-9H-pyrido[3,4-b]indole (PubChem CID 115051764) has the molecular formula C11H6BrClN2 and a molecular weight of 281.54 g/mol. Its IUPAC name is 6-bromo-1-chloro-9H-pyrido[3,4-b]indole.
| Compound Name | 6-bromo-1-chloro-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 115051764 |
| Molecular Formula | C11H6BrClN2 |
| Molecular Weight | 281.54 g/mol |
| Exact Mass | 279.94 |
| IUPAC Name | 6-bromo-1-chloro-9H-pyrido[3,4-b]indole |
| SMILES | Clc1nccc2c1[nH]c1ccc(Br)cc12 |
| InChI | InChI=1S/C11H6BrClN2/c12-6-1-2-9-8(5-6)7-3-4-14-11(13)10(7)15-9/h1-5,15H |
| InChIKey | UERFMTPZFPLUGQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|