C11H20F2N2O2S — CID 115051910
3-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-3-amine (PubChem CID 115051910) has the molecular formula C11H20F2N2O2S and a molecular weight of 282.36 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-3-amine.
| Compound Name | 3-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 115051910 |
| Molecular Formula | C11H20F2N2O2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-3-amine |
| SMILES | NC1(C(F)F)CCCN(C2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C11H20F2N2O2S/c12-10(13)11(14)4-1-5-15(8-11)9-2-6-18(16,17)7-3-9/h9-10H,1-8,14H2 |
| InChIKey | NPICXKMUMYVKGC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |