About 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine
4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine (PubChem CID 115051911) has the molecular formula C11H20F2N2O2S
and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine |
| PubChem CID | 115051911 |
| Molecular Formula | C11H20F2N2O2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine |
| SMILES | NC1(C(F)F)CCN(C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C11H20F2N2O2S/c12-10(13)11(14)3-5-15(6-4-11)9-1-7-18(16,17)8-2-9/h9-10H,1-8,14H2 |
| InChIKey | KSABCYRTVNJURJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine?
The IUPAC name of 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine (CID 115051911) is 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine.
What is the SMILES notation for 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine?
The canonical SMILES for 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine is NC1(C(F)F)CCN(C2CCS(=O)(=O)CC2)CC1.
What is the InChIKey of 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine?
The InChIKey is KSABCYRTVNJURJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2O2S/c12-10(13)11(14)3-5-15(6-4-11)9-1-7-18(16,17)8-2-9/h9-10H,1-8,14H2.
What are the key properties of 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine?
4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine has a molecular weight of 282.36 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)piperidin-4-amine is sourced from PubChem (CID 115051911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).