C15H21F3N2 — CID 115052335
4-(1,1-difluoroethyl)-2-fluoro-N-(2-piperidin-4-ylethyl)aniline (PubChem CID 115052335) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 4-(1,1-difluoroethyl)-2-fluoro-N-(2-piperidin-4-ylethyl)aniline.
| Compound Name | 4-(1,1-difluoroethyl)-2-fluoro-N-(2-piperidin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 115052335 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 4-(1,1-difluoroethyl)-2-fluoro-N-(2-piperidin-4-ylethyl)aniline |
| SMILES | CC(F)(F)c1ccc(NCCC2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C15H21F3N2/c1-15(17,18)12-2-3-14(13(16)10-12)20-9-6-11-4-7-19-8-5-11/h2-3,10-11,19-20H,4-9H2,1H3 |
| InChIKey | NTQANLXIODLCOY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |