C15H27FN2O2 — CID 115052344
tert-butyl 3-(4-fluoro-4-methylpyrrolidin-3-yl)piperidine-1-carboxylate (PubChem CID 115052344) has the molecular formula C15H27FN2O2 and a molecular weight of 286.39 g/mol. Its IUPAC name is tert-butyl 3-(4-fluoro-4-methylpyrrolidin-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-fluoro-4-methylpyrrolidin-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 115052344 |
| Molecular Formula | C15H27FN2O2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | tert-butyl 3-(4-fluoro-4-methylpyrrolidin-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C2CNCC2(C)F)C1 |
| InChI | InChI=1S/C15H27FN2O2/c1-14(2,3)20-13(19)18-7-5-6-11(9-18)12-8-17-10-15(12,4)16/h11-12,17H,5-10H2,1-4H3 |
| InChIKey | KFJOEMAYOQBLAX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |