About 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine
2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine (PubChem CID 115052625) has the molecular formula C12H14BrF2N
and a molecular weight of 290.15 g/mol. Its IUPAC name is 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine |
| PubChem CID | 115052625 |
| Molecular Formula | C12H14BrF2N |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine |
| SMILES | CC1(c2ccccc2Br)CC(F)(F)CCN1 |
| InChI | InChI=1S/C12H14BrF2N/c1-11(8-12(14,15)6-7-16-11)9-4-2-3-5-10(9)13/h2-5,16H,6-8H2,1H3 |
| InChIKey | XCOGXJJPFYKTCT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine?
The IUPAC name of 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine (CID 115052625) is 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine.
What is the SMILES notation for 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine?
The canonical SMILES for 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine is CC1(c2ccccc2Br)CC(F)(F)CCN1.
What is the InChIKey of 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine?
The InChIKey is XCOGXJJPFYKTCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrF2N/c1-11(8-12(14,15)6-7-16-11)9-4-2-3-5-10(9)13/h2-5,16H,6-8H2,1H3.
What are the key properties of 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine?
2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine has a molecular weight of 290.15 g/mol, XLogP of 3.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)-4,4-difluoro-2-methylpiperidine is sourced from PubChem (CID 115052625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).