C8H12BrN3O2S — CID 115053194
5-bromo-1-(1,1-dioxothian-4-yl)pyrazol-4-amine (PubChem CID 115053194) has the molecular formula C8H12BrN3O2S and a molecular weight of 294.17 g/mol. Its IUPAC name is 5-bromo-1-(1,1-dioxothian-4-yl)pyrazol-4-amine.
| Compound Name | 5-bromo-1-(1,1-dioxothian-4-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 115053194 |
| Molecular Formula | C8H12BrN3O2S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 5-bromo-1-(1,1-dioxothian-4-yl)pyrazol-4-amine |
| SMILES | Nc1cnn(C2CCS(=O)(=O)CC2)c1Br |
| InChI | InChI=1S/C8H12BrN3O2S/c9-8-7(10)5-11-12(8)6-1-3-15(13,14)4-2-6/h5-6H,1-4,10H2 |
| InChIKey | WKDSIOMSLCOXBN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |