About 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one
2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 115053372) has the molecular formula C14H14F3N3O
and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 115053372 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(C2CCCCN2)nc2cc(C(F)(F)F)ccn12 |
| InChI | InChI=1S/C14H14F3N3O/c15-14(16,17)9-4-6-20-12(7-9)19-11(8-13(20)21)10-3-1-2-5-18-10/h4,6-8,10,18H,1-3,5H2 |
| InChIKey | CAJUOKWXCWXAJL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one (CID 115053372) is 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one is O=c1cc(C2CCCCN2)nc2cc(C(F)(F)F)ccn12.
What is the InChIKey of 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is CAJUOKWXCWXAJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N3O/c15-14(16,17)9-4-6-20-12(7-9)19-11(8-13(20)21)10-3-1-2-5-18-10/h4,6-8,10,18H,1-3,5H2.
What are the key properties of 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one?
2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 297.28 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-2-yl-8-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 115053372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).