About 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol
4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol (PubChem CID 115053947) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol.
Molecular Properties
| Compound Name | 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol |
| PubChem CID | 115053947 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol |
| SMILES | Oc1ccc(-c2cnoc2C2CCNCC2)cc1 |
| InChI | InChI=1S/C14H16N2O2/c17-12-3-1-10(2-4-12)13-9-16-18-14(13)11-5-7-15-8-6-11/h1-4,9,11,15,17H,5-8H2 |
| InChIKey | AUJCCRUHJGFPHH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol?
The IUPAC name of 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol (CID 115053947) is 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol.
What is the SMILES notation for 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol?
The canonical SMILES for 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol is Oc1ccc(-c2cnoc2C2CCNCC2)cc1.
What is the InChIKey of 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol?
The InChIKey is AUJCCRUHJGFPHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2/c17-12-3-1-10(2-4-12)13-9-16-18-14(13)11-5-7-15-8-6-11/h1-4,9,11,15,17H,5-8H2.
What are the key properties of 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol?
4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol has a molecular weight of 244.29 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-piperidin-4-yl-1,2-oxazol-4-yl)phenol is sourced from PubChem (CID 115053947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).