C13H14FN3O — CID 115054613
6-fluoro-2-piperidin-3-ylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 115054613) has the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. Its IUPAC name is 6-fluoro-2-piperidin-3-ylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 6-fluoro-2-piperidin-3-ylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 115054613 |
| Molecular Formula | C13H14FN3O |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 6-fluoro-2-piperidin-3-ylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(C2CCCNC2)nc2cccc(F)n12 |
| InChI | InChI=1S/C13H14FN3O/c14-11-4-1-5-12-16-10(7-13(18)17(11)12)9-3-2-6-15-8-9/h1,4-5,7,9,15H,2-3,6,8H2 |
| InChIKey | PBIWQZUMXVCBRD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|