About 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one
7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 115054684) has the molecular formula C15H18FN3O
and a molecular weight of 275.33 g/mol. Its IUPAC name is 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 115054684 |
| Molecular Formula | C15H18FN3O |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CCC2CCNCC2)nc2ccc(F)cn12 |
| InChI | InChI=1S/C15H18FN3O/c16-12-2-4-14-18-13(9-15(20)19(14)10-12)3-1-11-5-7-17-8-6-11/h2,4,9-11,17H,1,3,5-8H2 |
| InChIKey | JYGNSTCVOIDIQA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one (CID 115054684) is 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one is O=c1cc(CCC2CCNCC2)nc2ccc(F)cn12.
What is the InChIKey of 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is JYGNSTCVOIDIQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FN3O/c16-12-2-4-14-18-13(9-15(20)19(14)10-12)3-1-11-5-7-17-8-6-11/h2,4,9-11,17H,1,3,5-8H2.
What are the key properties of 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one?
7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 275.33 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-(2-piperidin-4-ylethyl)pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 115054684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).