C41H43NO5 — CID 11505517
(2R,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-amine (PubChem CID 11505517) has the molecular formula C41H43NO5 and a molecular weight of 629.80 g/mol. Its IUPAC name is (2R,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-amine.
| Compound Name | (2R,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-amine |
|---|---|
| PubChem CID | 11505517 |
| Molecular Formula | C41H43NO5 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.31 |
| IUPAC Name | (2R,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-amine |
| SMILES | NC1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H43NO5/c42-36-37(43-26-31-16-6-1-7-17-31)39(45-28-33-20-10-3-11-21-33)41(47-30-35-24-14-5-15-25-35)40(46-29-34-22-12-4-13-23-34)38(36)44-27-32-18-8-2-9-19-32/h1-25,36-41H,26-30,42H2/t36?,37-,38+,39+,40-,41? |
| InChIKey | PHISBMUICPOTCC-QWVFVTBUSA-N |
| XLogP | 7.25 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |