C32H47NO10Si — CID 11505538
tert-butyl 3-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[2-(2,2-dimethylpropanoyloxymethoxy)-2-oxoacetyl]-4-oxoazetidin-2-yl]acetyl]benzoate (PubChem CID 11505538) has the molecular formula C32H47NO10Si and a molecular weight of 633.81 g/mol. Its IUPAC name is tert-butyl 3-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[2-(2,2-dimethylpropanoyloxymethoxy)-2-oxoacetyl]-4-oxoazetidin-2-yl]acetyl]benzoate.
| Compound Name | tert-butyl 3-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[2-(2,2-dimethylpropanoyloxymethoxy)-2-oxoacetyl]-4-oxoazetidin-2-yl]acetyl]benzoate |
|---|---|
| PubChem CID | 11505538 |
| Molecular Formula | C32H47NO10Si |
| Molecular Weight | 633.81 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | tert-butyl 3-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[2-(2,2-dimethylpropanoyloxymethoxy)-2-oxoacetyl]-4-oxoazetidin-2-yl]acetyl]benzoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N(C(=O)C(=O)OCOC(=O)C(C)(C)C)[C@@H]1CC(=O)c1cccc(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C32H47NO10Si/c1-19(43-44(11,12)32(8,9)10)24-22(17-23(34)20-14-13-15-21(16-20)27(37)42-31(5,6)7)33(25(24)35)26(36)28(38)40-18-41-29(39)30(2,3)4/h13-16,19,22,24H,17-18H2,1-12H3/t19-,22-,24-/m1/s1 |
| InChIKey | JKLGAHDBKAOUTO-ZFJSRUIDSA-N |
| XLogP | 5.07 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.81 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|