C13H23FN2O2 — CID 115055622
4-(fluoromethyl)-1-(1-methylpiperidin-4-yl)piperidine-4-carboxylic acid (PubChem CID 115055622) has the molecular formula C13H23FN2O2 and a molecular weight of 258.34 g/mol. Its IUPAC name is 4-(fluoromethyl)-1-(1-methylpiperidin-4-yl)piperidine-4-carboxylic acid.
| Compound Name | 4-(fluoromethyl)-1-(1-methylpiperidin-4-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 115055622 |
| Molecular Formula | C13H23FN2O2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4-(fluoromethyl)-1-(1-methylpiperidin-4-yl)piperidine-4-carboxylic acid |
| SMILES | CN1CCC(N2CCC(CF)(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C13H23FN2O2/c1-15-6-2-11(3-7-15)16-8-4-13(10-14,5-9-16)12(17)18/h11H,2-10H2,1H3,(H,17,18) |
| InChIKey | MRZFJTDFHHEJPZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |