C35H41F3O5SSi — CID 11505660
[(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-(trityloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl] trifluoromethanesulfonate (PubChem CID 11505660) has the molecular formula C35H41F3O5SSi and a molecular weight of 658.86 g/mol. Its IUPAC name is [(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-(trityloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-(trityloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11505660 |
| Molecular Formula | C35H41F3O5SSi |
| Molecular Weight | 658.86 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | [(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-(trityloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2C=C(OS(=O)(=O)C(F)(F)F)C[C@@H]2[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H41F3O5SSi/c1-33(2,3)45(4,5)43-32-22-25-21-29(42-44(39,40)35(36,37)38)23-30(25)31(32)24-41-34(26-15-9-6-10-16-26,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-21,25,30-32H,22-24H2,1-5H3/t25-,30-,31+,32+/m0/s1 |
| InChIKey | SCCNWLSVHAKCAA-SPJMRJSYSA-N |
| XLogP | 8.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.86 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|