C39H33N5O6 — CID 11505691
2-[(3R)-3-[(3-benzoylphenyl)carbamoylamino]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-(4-methoxyphenyl)-N-methylacetamide (PubChem CID 11505691) has the molecular formula C39H33N5O6 and a molecular weight of 667.72 g/mol. Its IUPAC name is 2-[(3R)-3-[(3-benzoylphenyl)carbamoylamino]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-(4-methoxyphenyl)-N-methylacetamide.
| Compound Name | 2-[(3R)-3-[(3-benzoylphenyl)carbamoylamino]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-(4-methoxyphenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 11505691 |
| Molecular Formula | C39H33N5O6 |
| Molecular Weight | 667.72 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | 2-[(3R)-3-[(3-benzoylphenyl)carbamoylamino]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-(4-methoxyphenyl)-N-methylacetamide |
| SMILES | COc1ccc(N(C)C(=O)CN2C(=O)[C@@H](NC(=O)Nc3cccc(C(=O)c4ccccc4)c3)C(=O)N(c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C39H33N5O6/c1-42(29-20-22-31(50-2)23-21-29)34(45)25-43-32-18-9-10-19-33(32)44(30-16-7-4-8-17-30)38(48)35(37(43)47)41-39(49)40-28-15-11-14-27(24-28)36(46)26-12-5-3-6-13-26/h3-24,35H,25H2,1-2H3,(H2,40,41,49)/t35-/m1/s1 |
| InChIKey | VTXGCIDTGZPAHD-PGUFJCEWSA-N |
| XLogP | 5.79 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|