C30H46N4O3 — CID 11505708
N-[3-[4-(3,3-diphenylpropylamino)butylamino]propyl]-N'-hydroxyoctanediamide (PubChem CID 11505708) has the molecular formula C30H46N4O3 and a molecular weight of 510.72 g/mol. Its IUPAC name is N-[3-[4-(3,3-diphenylpropylamino)butylamino]propyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[3-[4-(3,3-diphenylpropylamino)butylamino]propyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 11505708 |
| Molecular Formula | C30H46N4O3 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | N-[3-[4-(3,3-diphenylpropylamino)butylamino]propyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)NCCCNCCCCNCCC(c1ccccc1)c1ccccc1)NO |
| InChI | InChI=1S/C30H46N4O3/c35-29(18-9-1-2-10-19-30(36)34-37)33-24-13-23-31-21-11-12-22-32-25-20-28(26-14-5-3-6-15-26)27-16-7-4-8-17-27/h3-8,14-17,28,31-32,37H,1-2,9-13,18-25H2,(H,33,35)(H,34,36) |
| InChIKey | VNCLVAFRMCWEMG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|