About 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde
8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde (PubChem CID 115057497) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde.
Molecular Properties
| Compound Name | 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde |
| PubChem CID | 115057497 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde |
| SMILES | COc1cccc2c1C(C)=C(C=O)CC2 |
| InChI | InChI=1S/C13H14O2/c1-9-11(8-14)7-6-10-4-3-5-12(15-2)13(9)10/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | BGZXYNNPZDDUJL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde?
The IUPAC name of 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde (CID 115057497) is 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde.
What is the SMILES notation for 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde?
The canonical SMILES for 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde is COc1cccc2c1C(C)=C(C=O)CC2.
What is the InChIKey of 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde?
The InChIKey is BGZXYNNPZDDUJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-9-11(8-14)7-6-10-4-3-5-12(15-2)13(9)10/h3-5,8H,6-7H2,1-2H3.
What are the key properties of 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde?
8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde has a molecular weight of 202.25 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-1-methyl-3,4-dihydronaphthalene-2-carbaldehyde is sourced from PubChem (CID 115057497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).