C12H14N4 — CID 115058116
3-phenyl-4,5,6,7-tetrahydrobenzotriazol-4-amine (PubChem CID 115058116) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-phenyl-4,5,6,7-tetrahydrobenzotriazol-4-amine.
| Compound Name | 3-phenyl-4,5,6,7-tetrahydrobenzotriazol-4-amine |
|---|---|
| PubChem CID | 115058116 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-phenyl-4,5,6,7-tetrahydrobenzotriazol-4-amine |
| SMILES | NC1CCCc2nnn(-c3ccccc3)c21 |
| InChI | InChI=1S/C12H14N4/c13-10-7-4-8-11-12(10)16(15-14-11)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8,13H2 |
| InChIKey | TTWNUTHHBQIUQJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |