About 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine
3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine (PubChem CID 115058335) has the molecular formula C11H15F2N
and a molecular weight of 199.24 g/mol. Its IUPAC name is 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine.
Molecular Properties
| Compound Name | 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine |
| PubChem CID | 115058335 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine |
| SMILES | C=C/C=C(\C=C)CC(F)(F)C1CNC1 |
| InChI | InChI=1S/C11H15F2N/c1-3-5-9(4-2)6-11(12,13)10-7-14-8-10/h3-5,10,14H,1-2,6-8H2/b9-5+ |
| InChIKey | KLSNKZKFIDWNGW-WEVVVXLNSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine?
The IUPAC name of 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine (CID 115058335) is 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine.
What is the SMILES notation for 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine?
The canonical SMILES for 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine is C=C/C=C(\C=C)CC(F)(F)C1CNC1.
What is the InChIKey of 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine?
The InChIKey is KLSNKZKFIDWNGW-WEVVVXLNSA-N. The full InChI is InChI=1S/C11H15F2N/c1-3-5-9(4-2)6-11(12,13)10-7-14-8-10/h3-5,10,14H,1-2,6-8H2/b9-5+.
What are the key properties of 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine?
3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine has a molecular weight of 199.24 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3Z)-3-ethenyl-1,1-difluorohexa-3,5-dienyl]azetidine is sourced from PubChem (CID 115058335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).