About 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride
4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride (PubChem CID 115058491) has the molecular formula C10H20ClF2N
and a molecular weight of 227.73 g/mol. Its IUPAC name is 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride |
| PubChem CID | 115058491 |
| Molecular Formula | C10H20ClF2N |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride |
| SMILES | CC(C)(C)C(F)(F)C1CCNCC1.Cl |
| InChI | InChI=1S/C10H19F2N.ClH/c1-9(2,3)10(11,12)8-4-6-13-7-5-8;/h8,13H,4-7H2,1-3H3;1H |
| InChIKey | ZVZOITMLGWYPJE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride?
The IUPAC name of 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride (CID 115058491) is 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride.
What is the SMILES notation for 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride?
The canonical SMILES for 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride is CC(C)(C)C(F)(F)C1CCNCC1.Cl.
What is the InChIKey of 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride?
The InChIKey is ZVZOITMLGWYPJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2N.ClH/c1-9(2,3)10(11,12)8-4-6-13-7-5-8;/h8,13H,4-7H2,1-3H3;1H.
What are the key properties of 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride?
4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride has a molecular weight of 227.73 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-difluoro-2,2-dimethylpropyl)piperidine;hydrochloride is sourced from PubChem (CID 115058491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).