C24H72Si14 — CID 11505936
[2,2,3,3,5,5,6,6,7,7-decamethyl-4-(1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinan-1-yl)-1,2,3,4,5,6,7-heptasilabicyclo[2.2.1]heptan-1-yl]-trimethylsilane (PubChem CID 11505936) has the molecular formula C24H72Si14 and a molecular weight of 754.04 g/mol. Its IUPAC name is [2,2,3,3,5,5,6,6,7,7-decamethyl-4-(1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinan-1-yl)-1,2,3,4,5,6,7-heptasilabicyclo[2.2.1]heptan-1-yl]-trimethylsilane.
| Compound Name | [2,2,3,3,5,5,6,6,7,7-decamethyl-4-(1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinan-1-yl)-1,2,3,4,5,6,7-heptasilabicyclo[2.2.1]heptan-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11505936 |
| Molecular Formula | C24H72Si14 |
| Molecular Weight | 754.04 g/mol |
| Exact Mass | 752.24 |
| IUPAC Name | [2,2,3,3,5,5,6,6,7,7-decamethyl-4-(1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinan-1-yl)-1,2,3,4,5,6,7-heptasilabicyclo[2.2.1]heptan-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)[Si]12[Si](C)(C)[Si](C)(C)[Si]([Si]3(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si]3(C)C)([Si](C)(C)[Si]1(C)C)[Si]2(C)C |
| InChI | InChI=1S/C24H72Si14/c1-25(2,3)37-31(14,15)33(18,19)38(35(37,22)23,34(20,21)32(37,16)17)36(24)29(10,11)27(6,7)26(4,5)28(8,9)30(36,12)13/h1-24H3 |
| InChIKey | UPXVBSFLMJGCAY-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.04 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|