C52H38ClN5 — CID 11505963
2-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin chloride (PubChem CID 11505963) has the molecular formula C52H38ClN5 and a molecular weight of 768.36 g/mol. Its IUPAC name is 2-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin chloride.
| Compound Name | 2-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin chloride |
|---|---|
| PubChem CID | 11505963 |
| Molecular Formula | C52H38ClN5 |
| Molecular Weight | 768.36 g/mol |
| Exact Mass | 767.28 |
| IUPAC Name | 2-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin chloride |
| SMILES | C[n+]1ccccc1/C=C/c1cc2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc([nH]4)c2-c2ccccc2)C=C3)C=C1.[Cl-] |
| InChI | InChI=1S/C52H37N5.ClH/c1-57-33-15-14-24-40(57)26-25-39-34-47-50(37-20-10-4-11-21-37)45-30-29-43(54-45)48(35-16-6-2-7-17-35)41-27-28-42(53-41)49(36-18-8-3-9-19-36)44-31-32-46(55-44)51(52(39)56-47)38-22-12-5-13-23-38;/h2-34H,1H3,(H,53,54,55,56);1H/b50-45-; |
| InChIKey | VUMCJBZYAYXJGQ-PWMJVTNXSA-N |
| XLogP | 9.32 |
| TPSA | 61.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.36 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|