C9H11ClN4 — CID 115059664
(7-chloro-1-ethylbenzimidazol-2-yl)hydrazine (PubChem CID 115059664) has the molecular formula C9H11ClN4 and a molecular weight of 210.67 g/mol. Its IUPAC name is (7-chloro-1-ethylbenzimidazol-2-yl)hydrazine.
| Compound Name | (7-chloro-1-ethylbenzimidazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 115059664 |
| Molecular Formula | C9H11ClN4 |
| Molecular Weight | 210.67 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (7-chloro-1-ethylbenzimidazol-2-yl)hydrazine |
| SMILES | CCn1c(NN)nc2cccc(Cl)c21 |
| InChI | InChI=1S/C9H11ClN4/c1-2-14-8-6(10)4-3-5-7(8)12-9(14)13-11/h3-5H,2,11H2,1H3,(H,12,13) |
| InChIKey | VPGQVYXGSOFTSJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.67 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|