C49H52O5SSi — CID 11505988
tert-butyl-diphenyl-[[(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]silane (PubChem CID 11505988) has the molecular formula C49H52O5SSi and a molecular weight of 781.10 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 11505988 |
| Molecular Formula | C49H52O5SSi |
| Molecular Weight | 781.10 g/mol |
| Exact Mass | 780.33 |
| IUPAC Name | tert-butyl-diphenyl-[[(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C49H52O5SSi/c1-49(2,3)56(42-30-18-8-19-31-42,43-32-20-9-21-33-43)53-37-44-45(50-34-38-22-10-4-11-23-38)46(51-35-39-24-12-5-13-25-39)47(52-36-40-26-14-6-15-27-40)48(54-44)55-41-28-16-7-17-29-41/h4-33,44-48H,34-37H2,1-3H3/t44-,45-,46+,47-,48+/m1/s1 |
| InChIKey | ZWOBAOXNKNNDAD-ZTIJSMQHSA-N |
| XLogP | 9.84 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.10 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|