C14H14F3NO4 — CID 115060573
2-[5-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]morpholin-3-yl]acetic acid (PubChem CID 115060573) has the molecular formula C14H14F3NO4 and a molecular weight of 317.26 g/mol. Its IUPAC name is 2-[5-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]morpholin-3-yl]acetic acid.
| Compound Name | 2-[5-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 115060573 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-[5-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]morpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1COCC(=O)N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3NO4/c15-14(16,17)10-3-1-2-9(4-10)6-18-11(5-13(20)21)7-22-8-12(18)19/h1-4,11H,5-8H2,(H,20,21) |
| InChIKey | PROHBRYRLLUMEN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |