C11H11NO3 — CID 115060838
2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid (PubChem CID 115060838) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115060838 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid |
| SMILES | O=C(O)C1CN=C(Cc2ccccc2)O1 |
| InChI | InChI=1S/C11H11NO3/c13-11(14)9-7-12-10(15-9)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,14) |
| InChIKey | MVKVUHDVWNFXDY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |