2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid

C11H11NO3 — CID 115060838

IUPAC2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid
SMILESO=C(O)C1CN=C(Cc2ccccc2)O1
InChIInChI=1S/C11H11NO3/c13-11(14)9-7-12-10(15-9)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,14)
InChIKeyMVKVUHDVWNFXDY-UHFFFAOYSA-N
MW205.21 g/mol
LogP1.11
Rot. Bonds3

About 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid

2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid (PubChem CID 115060838) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid
PubChem CID115060838
Molecular FormulaC11H11NO3
Molecular Weight205.21 g/mol
Exact Mass205.07
IUPAC Name2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid
SMILESO=C(O)C1CN=C(Cc2ccccc2)O1
InChIInChI=1S/C11H11NO3/c13-11(14)9-7-12-10(15-9)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,14)
InChIKeyMVKVUHDVWNFXDY-UHFFFAOYSA-N
XLogP1.11
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.21
LogP ≤ 51.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid (CID 115060838) is 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid is O=C(O)C1CN=C(Cc2ccccc2)O1.
What is the InChIKey of 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid?
The InChIKey is MVKVUHDVWNFXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c13-11(14)9-7-12-10(15-9)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,14).
What are the key properties of 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid?
2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid has a molecular weight of 205.21 g/mol, XLogP of 1.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 115060838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).