3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid

C10H15NO3 — CID 115060954

IUPAC3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid
SMILESO=C(O)CCC1COC(C2CCC2)=N1
InChIInChI=1S/C10H15NO3/c12-9(13)5-4-8-6-14-10(11-8)7-2-1-3-7/h7-8H,1-6H2,(H,12,13)
InChIKeyCZSACPOBOJILBR-UHFFFAOYSA-N
MW197.23 g/mol
LogP1.45
Rot. Bonds4

About 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid

3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid (PubChem CID 115060954) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid.

Molecular Properties

Compound Name3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid
PubChem CID115060954
Molecular FormulaC10H15NO3
Molecular Weight197.23 g/mol
Exact Mass197.11
IUPAC Name3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid
SMILESO=C(O)CCC1COC(C2CCC2)=N1
InChIInChI=1S/C10H15NO3/c12-9(13)5-4-8-6-14-10(11-8)7-2-1-3-7/h7-8H,1-6H2,(H,12,13)
InChIKeyCZSACPOBOJILBR-UHFFFAOYSA-N
XLogP1.45
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.23
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid?
The IUPAC name of 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid (CID 115060954) is 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid.
What is the SMILES notation for 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid?
The canonical SMILES for 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid is O=C(O)CCC1COC(C2CCC2)=N1.
What is the InChIKey of 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid?
The InChIKey is CZSACPOBOJILBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c12-9(13)5-4-8-6-14-10(11-8)7-2-1-3-7/h7-8H,1-6H2,(H,12,13).
What are the key properties of 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid?
3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid has a molecular weight of 197.23 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-4-yl)propanoic acid is sourced from PubChem (CID 115060954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).