3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid

C10H17NO3 — CID 115061111

IUPAC3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid
SMILESCC(C)CC1=NC(CCC(=O)O)CO1
InChIInChI=1S/C10H17NO3/c1-7(2)5-9-11-8(6-14-9)3-4-10(12)13/h7-8H,3-6H2,1-2H3,(H,12,13)
InChIKeyUURLUCLIBSWVRD-UHFFFAOYSA-N
MW199.25 g/mol
LogP1.69
Rot. Bonds5

About 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid

3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid (PubChem CID 115061111) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid
PubChem CID115061111
Molecular FormulaC10H17NO3
Molecular Weight199.25 g/mol
Exact Mass199.12
IUPAC Name3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid
SMILESCC(C)CC1=NC(CCC(=O)O)CO1
InChIInChI=1S/C10H17NO3/c1-7(2)5-9-11-8(6-14-9)3-4-10(12)13/h7-8H,3-6H2,1-2H3,(H,12,13)
InChIKeyUURLUCLIBSWVRD-UHFFFAOYSA-N
XLogP1.69
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.25
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid?
The IUPAC name of 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid (CID 115061111) is 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid?
The canonical SMILES for 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid is CC(C)CC1=NC(CCC(=O)O)CO1.
What is the InChIKey of 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid?
The InChIKey is UURLUCLIBSWVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-7(2)5-9-11-8(6-14-9)3-4-10(12)13/h7-8H,3-6H2,1-2H3,(H,12,13).
What are the key properties of 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid?
3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid has a molecular weight of 199.25 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 115061111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).