About 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid
4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid (PubChem CID 115062197) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid |
| PubChem CID | 115062197 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid |
| SMILES | Cc1cccc(CC2COC(C(=O)O)=N2)c1 |
| InChI | InChI=1S/C12H13NO3/c1-8-3-2-4-9(5-8)6-10-7-16-11(13-10)12(14)15/h2-5,10H,6-7H2,1H3,(H,14,15) |
| InChIKey | DMLGJOAJBRTSMU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid?
The IUPAC name of 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid (CID 115062197) is 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid.
What is the SMILES notation for 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid?
The canonical SMILES for 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid is Cc1cccc(CC2COC(C(=O)O)=N2)c1.
What is the InChIKey of 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid?
The InChIKey is DMLGJOAJBRTSMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-8-3-2-4-9(5-8)6-10-7-16-11(13-10)12(14)15/h2-5,10H,6-7H2,1H3,(H,14,15).
What are the key properties of 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid?
4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid has a molecular weight of 219.24 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-methylphenyl)methyl]-4,5-dihydro-1,3-oxazole-2-carboxylic acid is sourced from PubChem (CID 115062197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).